C14H18CuN2O5S — CID 134105261
copper;1-methyl-2-(methylsulfinylmethyl)benzimidazole;diacetate (PubChem CID 134105261) has the molecular formula C14H18CuN2O5S and a molecular weight of 389.92 g/mol. Its IUPAC name is copper;1-methyl-2-(methylsulfinylmethyl)benzimidazole;diacetate.
| Compound Name | copper;1-methyl-2-(methylsulfinylmethyl)benzimidazole;diacetate |
|---|---|
| PubChem CID | 134105261 |
| Molecular Formula | C14H18CuN2O5S |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | copper;1-methyl-2-(methylsulfinylmethyl)benzimidazole;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].Cn1c(CS(C)=O)nc2ccccc21.[Cu+2] |
| InChI | InChI=1S/C10H12N2OS.2C2H4O2.Cu/c1-12-9-6-4-3-5-8(9)11-10(12)7-14(2)13;2*1-2(3)4;/h3-6H,7H2,1-2H3;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | APCKCTHYBZJQIE-UHFFFAOYSA-L |
| XLogP | -1.04 |
| TPSA | 115.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |