C15H14ClF2NOS — CID 115787127
2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanone (PubChem CID 115787127) has the molecular formula C15H14ClF2NOS and a molecular weight of 329.80 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanone.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 115787127 |
| Molecular Formula | C15H14ClF2NOS |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(4-chloro-2,5-difluorophenyl)ethanone |
| SMILES | CC(C)(C)c1csc(CC(=O)c2cc(F)c(Cl)cc2F)n1 |
| InChI | InChI=1S/C15H14ClF2NOS/c1-15(2,3)13-7-21-14(19-13)6-12(20)8-4-11(18)9(16)5-10(8)17/h4-5,7H,6H2,1-3H3 |
| InChIKey | WNAVORJTOASPMV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|