C15H20O3 — CID 115787732
(5-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone (PubChem CID 115787732) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (5-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (5-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 115787732 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (5-methylfuran-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| SMILES | Cc1cc(C(=O)C2CCOC3(CCCC3)C2)co1 |
| InChI | InChI=1S/C15H20O3/c1-11-8-13(10-17-11)14(16)12-4-7-18-15(9-12)5-2-3-6-15/h8,10,12H,2-7,9H2,1H3 |
| InChIKey | XAOPHPIQHCMQTD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |