C14H20F2O — CID 115788963
1-(2,4-difluoro-5-methylphenyl)-3-methylhexan-1-ol (PubChem CID 115788963) has the molecular formula C14H20F2O and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-3-methylhexan-1-ol.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-3-methylhexan-1-ol |
|---|---|
| PubChem CID | 115788963 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-3-methylhexan-1-ol |
| SMILES | CCCC(C)CC(O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C14H20F2O/c1-4-5-9(2)6-14(17)11-7-10(3)12(15)8-13(11)16/h7-9,14,17H,4-6H2,1-3H3 |
| InChIKey | TYFXBXGRSRMYSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |