C15H22F2O — CID 79730496
1-(2,4-difluoro-5-methylphenyl)-2-ethylhexan-1-ol (PubChem CID 79730496) has the molecular formula C15H22F2O and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-2-ethylhexan-1-ol.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-2-ethylhexan-1-ol |
|---|---|
| PubChem CID | 79730496 |
| Molecular Formula | C15H22F2O |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-2-ethylhexan-1-ol |
| SMILES | CCCCC(CC)C(O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C15H22F2O/c1-4-6-7-11(5-2)15(18)12-8-10(3)13(16)9-14(12)17/h8-9,11,15,18H,4-7H2,1-3H3 |
| InChIKey | RVJHOXISKFHVHA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |