C14H18ClF3 — CID 103303768
1-(1-chloro-2-ethylhexyl)-2,4,5-trifluorobenzene (PubChem CID 103303768) has the molecular formula C14H18ClF3 and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-(1-chloro-2-ethylhexyl)-2,4,5-trifluorobenzene.
| Compound Name | 1-(1-chloro-2-ethylhexyl)-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103303768 |
| Molecular Formula | C14H18ClF3 |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-(1-chloro-2-ethylhexyl)-2,4,5-trifluorobenzene |
| SMILES | CCCCC(CC)C(Cl)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H18ClF3/c1-3-5-6-9(4-2)14(15)10-7-12(17)13(18)8-11(10)16/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | FFIJUFVWLJKSGX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|