C12H17BrOS — CID 115790909
2-(3-bromothiophen-2-yl)-1-(1-methylcyclopentyl)ethanol (PubChem CID 115790909) has the molecular formula C12H17BrOS and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(1-methylcyclopentyl)ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(1-methylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 115790909 |
| Molecular Formula | C12H17BrOS |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(1-methylcyclopentyl)ethanol |
| SMILES | CC1(C(O)Cc2sccc2Br)CCCC1 |
| InChI | InChI=1S/C12H17BrOS/c1-12(5-2-3-6-12)11(14)8-10-9(13)4-7-15-10/h4,7,11,14H,2-3,5-6,8H2,1H3 |
| InChIKey | AMMZTBYFPICSRL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |