C14H17FO4S — CID 115800343
1-(1,1-dioxothian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanone (PubChem CID 115800343) has the molecular formula C14H17FO4S and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanone.
| Compound Name | 1-(1,1-dioxothian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 115800343 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)C2CCCCS2(=O)=O)c1F |
| InChI | InChI=1S/C14H17FO4S/c1-19-12-6-4-5-10(14(12)15)9-11(16)13-7-2-3-8-20(13,17)18/h4-6,13H,2-3,7-9H2,1H3 |
| InChIKey | XQORIARSZMYJQV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |