C14H11Cl2IO — CID 115802046
2-(2,5-dichlorophenyl)-1-(4-iodophenyl)ethanol (PubChem CID 115802046) has the molecular formula C14H11Cl2IO and a molecular weight of 393.05 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(4-iodophenyl)ethanol.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(4-iodophenyl)ethanol |
|---|---|
| PubChem CID | 115802046 |
| Molecular Formula | C14H11Cl2IO |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(4-iodophenyl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11Cl2IO/c15-11-3-6-13(16)10(7-11)8-14(18)9-1-4-12(17)5-2-9/h1-7,14,18H,8H2 |
| InChIKey | KGRGRLXIBXWLGY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|