C12H8Br2Cl2O2 — CID 65317285
1-(4,5-dibromofuran-2-yl)-2-(2,5-dichlorophenyl)ethanol (PubChem CID 65317285) has the molecular formula C12H8Br2Cl2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-2-(2,5-dichlorophenyl)ethanol.
| Compound Name | 1-(4,5-dibromofuran-2-yl)-2-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 65317285 |
| Molecular Formula | C12H8Br2Cl2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 411.83 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-2-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C12H8Br2Cl2O2/c13-8-5-11(18-12(8)14)10(17)4-6-3-7(15)1-2-9(6)16/h1-3,5,10,17H,4H2 |
| InChIKey | RQYWOZAPZHYYKG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |