C14H26O3S — CID 115806093
(3,4-dimethylcyclohexyl)-(1,1-dioxothian-2-yl)methanol (PubChem CID 115806093) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(1,1-dioxothian-2-yl)methanol.
| Compound Name | (3,4-dimethylcyclohexyl)-(1,1-dioxothian-2-yl)methanol |
|---|---|
| PubChem CID | 115806093 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(1,1-dioxothian-2-yl)methanol |
| SMILES | CC1CCC(C(O)C2CCCCS2(=O)=O)CC1C |
| InChI | InChI=1S/C14H26O3S/c1-10-6-7-12(9-11(10)2)14(15)13-5-3-4-8-18(13,16)17/h10-15H,3-9H2,1-2H3 |
| InChIKey | CHCQRAKZICFUKL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |