C13H23F3O3S — CID 105101851
4-ethylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butan-1-ol (PubChem CID 105101851) has the molecular formula C13H23F3O3S and a molecular weight of 316.39 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butan-1-ol.
| Compound Name | 4-ethylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butan-1-ol |
|---|---|
| PubChem CID | 105101851 |
| Molecular Formula | C13H23F3O3S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-ethylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3O3S/c1-2-20(18,19)9-3-4-12(17)10-5-7-11(8-6-10)13(14,15)16/h10-12,17H,2-9H2,1H3 |
| InChIKey | SMSVVKOCBHHKOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |