C11H19F3O — CID 115808726
1-(1-ethylcyclopentyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 115808726) has the molecular formula C11H19F3O and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-(1-ethylcyclopentyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(1-ethylcyclopentyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 115808726 |
| Molecular Formula | C11H19F3O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(1-ethylcyclopentyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | CCC1(C(O)CCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H19F3O/c1-2-10(6-3-4-7-10)9(15)5-8-11(12,13)14/h9,15H,2-8H2,1H3 |
| InChIKey | MBYDNYYXTWKDBF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |