C17H19FN2O2 — CID 11580890
[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 5-fluoro-1H-indole-3-carboxylate (PubChem CID 11580890) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 5-fluoro-1H-indole-3-carboxylate.
| Compound Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 5-fluoro-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 11580890 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 5-fluoro-1H-indole-3-carboxylate |
| SMILES | O=C(OC[C@@H]1CCN2CCC[C@@H]12)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C17H19FN2O2/c18-12-3-4-15-13(8-12)14(9-19-15)17(21)22-10-11-5-7-20-6-1-2-16(11)20/h3-4,8-9,11,16,19H,1-2,5-7,10H2/t11-,16-/m0/s1 |
| InChIKey | GEYWOYIZWUBCMC-ZBEGNZNMSA-N |
| XLogP | 2.95 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |