C19H32O2 — CID 115814070
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanone (PubChem CID 115814070) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 115814070 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
| SMILES | CC1(C)CC(C(=O)C2CCC3CCCCC3C2)C(C)(C)O1 |
| InChI | InChI=1S/C19H32O2/c1-18(2)12-16(19(3,4)21-18)17(20)15-10-9-13-7-5-6-8-14(13)11-15/h13-16H,5-12H2,1-4H3 |
| InChIKey | DHULPZSNTMEWHM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |