C22H22N2O4 — CID 11581659
2-(1H-indol-3-yl)acetic acid;4-(1H-indol-3-yl)butanoic acid (PubChem CID 11581659) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)acetic acid;4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-(1H-indol-3-yl)acetic acid;4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 11581659 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(1H-indol-3-yl)acetic acid;4-(1H-indol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCc1c[nH]c2ccccc12.O=C(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13NO2.C10H9NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);1-4,6,11H,5H2,(H,12,13) |
| InChIKey | YALNAERMZVRVNL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |