C15H20N2O2 — CID 115818506
2-(1-methylbenzimidazol-2-yl)-1-(3-methyloxolan-2-yl)ethanol (PubChem CID 115818506) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-1-(3-methyloxolan-2-yl)ethanol.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-1-(3-methyloxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 115818506 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-1-(3-methyloxolan-2-yl)ethanol |
| SMILES | CC1CCOC1C(O)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C15H20N2O2/c1-10-7-8-19-15(10)13(18)9-14-16-11-5-3-4-6-12(11)17(14)2/h3-6,10,13,15,18H,7-9H2,1-2H3 |
| InChIKey | FXHHWYFYZGHLHI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |