C21H20ClN5O — CID 11581960
1-(4-chlorophenyl)-3-[3-(2-pyrrolidin-1-ylpyrimidin-4-yl)phenyl]urea (PubChem CID 11581960) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(2-pyrrolidin-1-ylpyrimidin-4-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(2-pyrrolidin-1-ylpyrimidin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 11581960 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(2-pyrrolidin-1-ylpyrimidin-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2ccnc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C21H20ClN5O/c22-16-6-8-17(9-7-16)24-21(28)25-18-5-3-4-15(14-18)19-10-11-23-20(26-19)27-12-1-2-13-27/h3-11,14H,1-2,12-13H2,(H2,24,25,28) |
| InChIKey | NKGIFOQCBMXHAI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |