C12H19NO2S2 — CID 115820927
1-(4-methylsulfanylphenyl)-4-methylsulfonylbutan-1-amine (PubChem CID 115820927) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(4-methylsulfanylphenyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 115820927 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-4-methylsulfonylbutan-1-amine |
| SMILES | CSc1ccc(C(N)CCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO2S2/c1-16-11-7-5-10(6-8-11)12(13)4-3-9-17(2,14)15/h5-8,12H,3-4,9,13H2,1-2H3 |
| InChIKey | MJUMWPFOJWPRRU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |