C12H20N2S — CID 116933901
N'-methyl-1-(4-methylsulfanylphenyl)butane-1,4-diamine (PubChem CID 116933901) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N'-methyl-1-(4-methylsulfanylphenyl)butane-1,4-diamine.
| Compound Name | N'-methyl-1-(4-methylsulfanylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116933901 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-methyl-1-(4-methylsulfanylphenyl)butane-1,4-diamine |
| SMILES | CNCCCC(N)c1ccc(SC)cc1 |
| InChI | InChI=1S/C12H20N2S/c1-14-9-3-4-12(13)10-5-7-11(15-2)8-6-10/h5-8,12,14H,3-4,9,13H2,1-2H3 |
| InChIKey | ZPMQZZWPKDRMDM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|