C17H19NS2 — CID 115823579
2-(1-benzothiophen-3-yl)-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine (PubChem CID 115823579) has the molecular formula C17H19NS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115823579 |
| Molecular Formula | C17H19NS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine |
| SMILES | CCNC(Cc1csc2ccccc12)c1sccc1C |
| InChI | InChI=1S/C17H19NS2/c1-3-18-15(17-12(2)8-9-19-17)10-13-11-20-16-7-5-4-6-14(13)16/h4-9,11,15,18H,3,10H2,1-2H3 |
| InChIKey | KQSHLPOZPGDWNU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |