C17H18ClNS2 — CID 103405423
2-(1-benzothiophen-3-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine (PubChem CID 103405423) has the molecular formula C17H18ClNS2 and a molecular weight of 335.93 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103405423 |
| Molecular Formula | C17H18ClNS2 |
| Molecular Weight | 335.93 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1csc2ccccc12)c1scc(C)c1Cl |
| InChI | InChI=1S/C17H18ClNS2/c1-3-19-14(17-16(18)11(2)9-21-17)8-12-10-20-15-7-5-4-6-13(12)15/h4-7,9-10,14,19H,3,8H2,1-2H3 |
| InChIKey | PSVRUPPKGJWSIA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.93 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |