C16H19Cl2NOS — CID 103405686
2-(5-chloro-2-methoxyphenyl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine (PubChem CID 103405686) has the molecular formula C16H19Cl2NOS and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103405686 |
| Molecular Formula | C16H19Cl2NOS |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(3-chloro-4-methylthiophen-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Cl)ccc1OC)c1scc(C)c1Cl |
| InChI | InChI=1S/C16H19Cl2NOS/c1-4-19-13(16-15(18)10(2)9-21-16)8-11-7-12(17)5-6-14(11)20-3/h5-7,9,13,19H,4,8H2,1-3H3 |
| InChIKey | WMKHOFGNPFXSRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |