C17H22ClNOS — CID 103405432
1-(3-chloro-4-methylthiophen-2-yl)-N-ethyl-2-(2-methoxy-5-methylphenyl)ethanamine (PubChem CID 103405432) has the molecular formula C17H22ClNOS and a molecular weight of 323.89 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-N-ethyl-2-(2-methoxy-5-methylphenyl)ethanamine.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-N-ethyl-2-(2-methoxy-5-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 103405432 |
| Molecular Formula | C17H22ClNOS |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-N-ethyl-2-(2-methoxy-5-methylphenyl)ethanamine |
| SMILES | CCNC(Cc1cc(C)ccc1OC)c1scc(C)c1Cl |
| InChI | InChI=1S/C17H22ClNOS/c1-5-19-14(17-16(18)12(3)10-21-17)9-13-8-11(2)6-7-15(13)20-4/h6-8,10,14,19H,5,9H2,1-4H3 |
| InChIKey | QMBRDHPZWAQXDT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |