C18H18ClNS — CID 115823976
2-(1-benzothiophen-3-yl)-1-(4-chloro-3-methylphenyl)-N-methylethanamine (PubChem CID 115823976) has the molecular formula C18H18ClNS and a molecular weight of 315.87 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-chloro-3-methylphenyl)-N-methylethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-chloro-3-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115823976 |
| Molecular Formula | C18H18ClNS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-chloro-3-methylphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1csc2ccccc12)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C18H18ClNS/c1-12-9-13(7-8-16(12)19)17(20-2)10-14-11-21-18-6-4-3-5-15(14)18/h3-9,11,17,20H,10H2,1-2H3 |
| InChIKey | CGVCFLFIPGOQGO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |