C17H16ClNOS — CID 115824040
2-(1-benzothiophen-3-yl)-1-(4-chloro-2-methoxyphenyl)ethanamine (PubChem CID 115824040) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-chloro-2-methoxyphenyl)ethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-chloro-2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115824040 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-chloro-2-methoxyphenyl)ethanamine |
| SMILES | COc1cc(Cl)ccc1C(N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C17H16ClNOS/c1-20-16-9-12(18)6-7-14(16)15(19)8-11-10-21-17-5-3-2-4-13(11)17/h2-7,9-10,15H,8,19H2,1H3 |
| InChIKey | KWVBUZWVBNFZJO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |