C16H13Cl2NS — CID 115823854
2-(1-benzothiophen-3-yl)-1-(2,5-dichlorophenyl)ethanamine (PubChem CID 115823854) has the molecular formula C16H13Cl2NS and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(2,5-dichlorophenyl)ethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(2,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115823854 |
| Molecular Formula | C16H13Cl2NS |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(2,5-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1csc2ccccc12)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2NS/c17-11-5-6-14(18)13(8-11)15(19)7-10-9-20-16-4-2-1-3-12(10)16/h1-6,8-9,15H,7,19H2 |
| InChIKey | UWQJQJLWGUVYGD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |