C12H10Cl3NS — CID 115841631
2-(5-chlorothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanamine (PubChem CID 115841631) has the molecular formula C12H10Cl3NS and a molecular weight of 306.65 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115841631 |
| Molecular Formula | C12H10Cl3NS |
| Molecular Weight | 306.65 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-(2,5-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)s1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H10Cl3NS/c13-7-1-3-10(14)9(5-7)11(16)6-8-2-4-12(15)17-8/h1-5,11H,6,16H2 |
| InChIKey | DNJMOOATFWOUGL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |