C18H29N3 — CID 115826950
N-[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(pyrimidin-5-yl)methyl]propan-1-amine (PubChem CID 115826950) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(pyrimidin-5-yl)methyl]propan-1-amine.
| Compound Name | N-[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(pyrimidin-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115826950 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N-[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(pyrimidin-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cncnc1)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H29N3/c1-2-9-21-18(17-11-19-13-20-12-17)16-8-7-14-5-3-4-6-15(14)10-16/h11-16,18,21H,2-10H2,1H3 |
| InChIKey | IACJZNMURDYSQJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |