C18H31N — CID 115819269
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-N-propylpent-3-yn-1-amine (PubChem CID 115819269) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-N-propylpent-3-yn-1-amine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-N-propylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 115819269 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-N-propylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCCC)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H31N/c1-3-5-10-18(19-13-4-2)17-12-11-15-8-6-7-9-16(15)14-17/h15-19H,4,6-14H2,1-2H3 |
| InChIKey | WFQGOPTXTMJSKO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|