C26H29NO3S — CID 11582911
(3aE,9E)-4,6,9-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,5,7-tetrahydrocycloocta[c]pyrrol-8-one (PubChem CID 11582911) has the molecular formula C26H29NO3S and a molecular weight of 435.59 g/mol. Its IUPAC name is (3aE,9E)-4,6,9-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,5,7-tetrahydrocycloocta[c]pyrrol-8-one.
| Compound Name | (3aE,9E)-4,6,9-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,5,7-tetrahydrocycloocta[c]pyrrol-8-one |
|---|---|
| PubChem CID | 11582911 |
| Molecular Formula | C26H29NO3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (3aE,9E)-4,6,9-trimethyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,5,7-tetrahydrocycloocta[c]pyrrol-8-one |
| SMILES | C/C1=C2\CN(S(=O)(=O)c3ccc(C)cc3)C\C2=C(/C)C(=O)CC(C)(c2ccccc2)C1 |
| InChI | InChI=1S/C26H29NO3S/c1-18-10-12-22(13-11-18)31(29,30)27-16-23-19(2)14-26(4,21-8-6-5-7-9-21)15-25(28)20(3)24(23)17-27/h5-13H,14-17H2,1-4H3/b23-19-,24-20- |
| InChIKey | SIQRPUYXWCFGKQ-SRPFLQSCSA-N |
| XLogP | 4.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |