C19H12BrClF3N3O — CID 11583640
5-(4-bromophenyl)-2-(7-chloroquinolin-4-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol (PubChem CID 11583640) has the molecular formula C19H12BrClF3N3O and a molecular weight of 470.68 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-(7-chloroquinolin-4-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol.
| Compound Name | 5-(4-bromophenyl)-2-(7-chloroquinolin-4-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 11583640 |
| Molecular Formula | C19H12BrClF3N3O |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | 5-(4-bromophenyl)-2-(7-chloroquinolin-4-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| SMILES | OC1(C(F)(F)F)CC(c2ccc(Br)cc2)=NN1c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H12BrClF3N3O/c20-12-3-1-11(2-4-12)16-10-18(28,19(22,23)24)27(26-16)17-7-8-25-15-9-13(21)5-6-14(15)17/h1-9,28H,10H2 |
| InChIKey | HIIZYULEWVDCPP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_5_C(2)', 'substructure': 'N/A'} |
|---|