C14H16F2N2O2 — CID 115837028
2-(3,4-difluorophenyl)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol (PubChem CID 115837028) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 115837028 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol |
| SMILES | CCn1ncc(OC)c1C(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16F2N2O2/c1-3-18-14(13(20-2)8-17-18)12(19)7-9-4-5-10(15)11(16)6-9/h4-6,8,12,19H,3,7H2,1-2H3 |
| InChIKey | XBYBKZRYKDAJBG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |