C16H30O3 — CID 115838835
3-(oxan-2-yl)-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol (PubChem CID 115838835) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 3-(oxan-2-yl)-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol.
| Compound Name | 3-(oxan-2-yl)-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 115838835 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 3-(oxan-2-yl)-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-ol |
| SMILES | CC1(C)CC(C(O)CCC2CCCCO2)C(C)(C)O1 |
| InChI | InChI=1S/C16H30O3/c1-15(2)11-13(16(3,4)19-15)14(17)9-8-12-7-5-6-10-18-12/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | BQNPZZIITTZDKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |