C14H11Cl4N — CID 115839922
2-(2,4-dichlorophenyl)-1-(2,6-dichlorophenyl)ethanamine (PubChem CID 115839922) has the molecular formula C14H11Cl4N and a molecular weight of 335.06 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(2,6-dichlorophenyl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(2,6-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115839922 |
| Molecular Formula | C14H11Cl4N |
| Molecular Weight | 335.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(2,6-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)cc1Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl4N/c15-9-5-4-8(12(18)7-9)6-13(19)14-10(16)2-1-3-11(14)17/h1-5,7,13H,6,19H2 |
| InChIKey | CKDJHFOMMYRTBF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |