C15H17BrINS — CID 115840948
N-[2-(5-bromothiophen-2-yl)-1-(3-iodophenyl)ethyl]propan-1-amine (PubChem CID 115840948) has the molecular formula C15H17BrINS and a molecular weight of 450.18 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)-1-(3-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)-1-(3-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115840948 |
| Molecular Formula | C15H17BrINS |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 448.93 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)-1-(3-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)s1)c1cccc(I)c1 |
| InChI | InChI=1S/C15H17BrINS/c1-2-8-18-14(10-13-6-7-15(16)19-13)11-4-3-5-12(17)9-11/h3-7,9,14,18H,2,8,10H2,1H3 |
| InChIKey | FCBCLDKLQUFEKI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|