C15H20BrNS2 — CID 105136104
N-[1-(5-bromothiophen-3-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 105136104) has the molecular formula C15H20BrNS2 and a molecular weight of 358.37 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-3-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromothiophen-3-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105136104 |
| Molecular Formula | C15H20BrNS2 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-[1-(5-bromothiophen-3-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(CC)s1)c1csc(Br)c1 |
| InChI | InChI=1S/C15H20BrNS2/c1-3-7-17-14(11-8-15(16)18-10-11)9-13-6-5-12(4-2)19-13/h5-6,8,10,14,17H,3-4,7,9H2,1-2H3 |
| InChIKey | UVKOJFNSBGIVAV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |