C16H23NS2 — CID 115842479
N-[2-(5-ethylthiophen-2-yl)-1-(5-methylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 115842479) has the molecular formula C16H23NS2 and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[2-(5-ethylthiophen-2-yl)-1-(5-methylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-ethylthiophen-2-yl)-1-(5-methylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115842479 |
| Molecular Formula | C16H23NS2 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[2-(5-ethylthiophen-2-yl)-1-(5-methylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(CC)s1)c1ccc(C)s1 |
| InChI | InChI=1S/C16H23NS2/c1-4-10-17-15(16-9-6-12(3)18-16)11-14-8-7-13(5-2)19-14/h6-9,15,17H,4-5,10-11H2,1-3H3 |
| InChIKey | BBIOLOMVNLZIOU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |