C17H22INS — CID 115842306
N-[2-(5-ethylthiophen-2-yl)-1-(2-iodophenyl)ethyl]propan-1-amine (PubChem CID 115842306) has the molecular formula C17H22INS and a molecular weight of 399.34 g/mol. Its IUPAC name is N-[2-(5-ethylthiophen-2-yl)-1-(2-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-ethylthiophen-2-yl)-1-(2-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115842306 |
| Molecular Formula | C17H22INS |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[2-(5-ethylthiophen-2-yl)-1-(2-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(CC)s1)c1ccccc1I |
| InChI | InChI=1S/C17H22INS/c1-3-11-19-17(15-7-5-6-8-16(15)18)12-14-10-9-13(4-2)20-14/h5-10,17,19H,3-4,11-12H2,1-2H3 |
| InChIKey | XDFZRRYUOGNEIL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|