C19H24IN — CID 63527278
N-[2-(3,4-dimethylphenyl)-1-(2-iodophenyl)ethyl]propan-1-amine (PubChem CID 63527278) has the molecular formula C19H24IN and a molecular weight of 393.31 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)-1-(2-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3,4-dimethylphenyl)-1-(2-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63527278 |
| Molecular Formula | C19H24IN |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)-1-(2-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(C)c(C)c1)c1ccccc1I |
| InChI | InChI=1S/C19H24IN/c1-4-11-21-19(17-7-5-6-8-18(17)20)13-16-10-9-14(2)15(3)12-16/h5-10,12,19,21H,4,11,13H2,1-3H3 |
| InChIKey | OCDDSRBCCLWZQZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|