C17H19BrIN — CID 63528987
N-[2-(3-bromophenyl)-1-(2-iodophenyl)ethyl]propan-1-amine (PubChem CID 63528987) has the molecular formula C17H19BrIN and a molecular weight of 444.15 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-1-(2-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-bromophenyl)-1-(2-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63528987 |
| Molecular Formula | C17H19BrIN |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | N-[2-(3-bromophenyl)-1-(2-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(Br)c1)c1ccccc1I |
| InChI | InChI=1S/C17H19BrIN/c1-2-10-20-17(15-8-3-4-9-16(15)19)12-13-6-5-7-14(18)11-13/h3-9,11,17,20H,2,10,12H2,1H3 |
| InChIKey | OCOMKTIGWMEJHN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|