C15H23N3S2 — CID 105136145
N-[1-(4-ethylthiadiazol-5-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 105136145) has the molecular formula C15H23N3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is N-[1-(4-ethylthiadiazol-5-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-ethylthiadiazol-5-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105136145 |
| Molecular Formula | C15H23N3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[1-(4-ethylthiadiazol-5-yl)-2-(5-ethylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(CC)s1)c1snnc1CC |
| InChI | InChI=1S/C15H23N3S2/c1-4-9-16-14(15-13(6-3)17-18-20-15)10-12-8-7-11(5-2)19-12/h7-8,14,16H,4-6,9-10H2,1-3H3 |
| InChIKey | SAKBBFAGFROKIX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |