C14H18BrNOS2 — CID 115841074
N-[2-(5-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]propan-1-amine (PubChem CID 115841074) has the molecular formula C14H18BrNOS2 and a molecular weight of 360.34 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115841074 |
| Molecular Formula | C14H18BrNOS2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)s1)c1cc(OC)cs1 |
| InChI | InChI=1S/C14H18BrNOS2/c1-3-6-16-12(8-11-4-5-14(15)19-11)13-7-10(17-2)9-18-13/h4-5,7,9,12,16H,3,6,8H2,1-2H3 |
| InChIKey | JSQZUJBYBICLLG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |