C19H27NS — CID 115844177
N-[1-(3-methylthiophen-2-yl)-2-(4-propan-2-ylphenyl)ethyl]propan-1-amine (PubChem CID 115844177) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is N-[1-(3-methylthiophen-2-yl)-2-(4-propan-2-ylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-methylthiophen-2-yl)-2-(4-propan-2-ylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115844177 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[1-(3-methylthiophen-2-yl)-2-(4-propan-2-ylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(C(C)C)cc1)c1sccc1C |
| InChI | InChI=1S/C19H27NS/c1-5-11-20-18(19-15(4)10-12-21-19)13-16-6-8-17(9-7-16)14(2)3/h6-10,12,14,18,20H,5,11,13H2,1-4H3 |
| InChIKey | AEKIMKUBFFFIIW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |