C14H23NO2S — CID 115847088
N-ethyl-1-(3-methoxythiophen-2-yl)-2-(oxan-4-yl)ethanamine (PubChem CID 115847088) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-ethyl-1-(3-methoxythiophen-2-yl)-2-(oxan-4-yl)ethanamine.
| Compound Name | N-ethyl-1-(3-methoxythiophen-2-yl)-2-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 115847088 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-ethyl-1-(3-methoxythiophen-2-yl)-2-(oxan-4-yl)ethanamine |
| SMILES | CCNC(CC1CCOCC1)c1sccc1OC |
| InChI | InChI=1S/C14H23NO2S/c1-3-15-12(10-11-4-7-17-8-5-11)14-13(16-2)6-9-18-14/h6,9,11-12,15H,3-5,7-8,10H2,1-2H3 |
| InChIKey | OJLNVQUKBOGYOR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |