C13H17Cl2N — CID 115847384
2-cyclopentyl-1-(3,5-dichlorophenyl)ethanamine (PubChem CID 115847384) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-cyclopentyl-1-(3,5-dichlorophenyl)ethanamine.
| Compound Name | 2-cyclopentyl-1-(3,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115847384 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-cyclopentyl-1-(3,5-dichlorophenyl)ethanamine |
| SMILES | NC(CC1CCCC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N/c14-11-6-10(7-12(15)8-11)13(16)5-9-3-1-2-4-9/h6-9,13H,1-5,16H2 |
| InChIKey | VLTQRYXNSYMOMR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |