C19H31N — CID 115850456
2-cycloheptyl-1-(2,3-dimethylphenyl)-N-ethylethanamine (PubChem CID 115850456) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-cycloheptyl-1-(2,3-dimethylphenyl)-N-ethylethanamine.
| Compound Name | 2-cycloheptyl-1-(2,3-dimethylphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 115850456 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-cycloheptyl-1-(2,3-dimethylphenyl)-N-ethylethanamine |
| SMILES | CCNC(CC1CCCCCC1)c1cccc(C)c1C |
| InChI | InChI=1S/C19H31N/c1-4-20-19(14-17-11-7-5-6-8-12-17)18-13-9-10-15(2)16(18)3/h9-10,13,17,19-20H,4-8,11-12,14H2,1-3H3 |
| InChIKey | KHMKJXYWIUDVDJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |