C16H25N — CID 55110608
2-cyclopentyl-N-ethyl-1-(2-methylphenyl)ethanamine (PubChem CID 55110608) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-cyclopentyl-N-ethyl-1-(2-methylphenyl)ethanamine.
| Compound Name | 2-cyclopentyl-N-ethyl-1-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 55110608 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-cyclopentyl-N-ethyl-1-(2-methylphenyl)ethanamine |
| SMILES | CCNC(CC1CCCC1)c1ccccc1C |
| InChI | InChI=1S/C16H25N/c1-3-17-16(12-14-9-5-6-10-14)15-11-7-4-8-13(15)2/h4,7-8,11,14,16-17H,3,5-6,9-10,12H2,1-2H3 |
| InChIKey | SGHNLLKDISGMGY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |