C19H21NS — CID 115851065
N-[(3-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]ethanamine (PubChem CID 115851065) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]ethanamine.
| Compound Name | N-[(3-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 115851065 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)-naphthalen-2-ylmethyl]ethanamine |
| SMILES | CCNC(c1ccc2ccccc2c1)c1sccc1CC |
| InChI | InChI=1S/C19H21NS/c1-3-14-11-12-21-19(14)18(20-4-2)17-10-9-15-7-5-6-8-16(15)13-17/h5-13,18,20H,3-4H2,1-2H3 |
| InChIKey | KJOAOZIPPDZVQY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |