C32H35ClF2N4O3S — CID 11585392
(1R,5S)-7-[2-[3-(2-chloro-3,6-difluorophenoxy)propyl]-1,3-thiazol-5-yl]-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 11585392) has the molecular formula C32H35ClF2N4O3S and a molecular weight of 629.17 g/mol. Its IUPAC name is (1R,5S)-7-[2-[3-(2-chloro-3,6-difluorophenoxy)propyl]-1,3-thiazol-5-yl]-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (1R,5S)-7-[2-[3-(2-chloro-3,6-difluorophenoxy)propyl]-1,3-thiazol-5-yl]-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 11585392 |
| Molecular Formula | C32H35ClF2N4O3S |
| Molecular Weight | 629.17 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (1R,5S)-7-[2-[3-(2-chloro-3,6-difluorophenoxy)propyl]-1,3-thiazol-5-yl]-N-cyclopropyl-N-[(3-methoxy-2-methylphenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | COc1cccc(CN(C(=O)C2=C(c3cnc(CCCOc4c(F)ccc(F)c4Cl)s3)C[C@@H]3CNC[C@H]2N3)C2CC2)c1C |
| InChI | InChI=1S/C32H35ClF2N4O3S/c1-18-19(5-3-6-26(18)41-2)17-39(21-8-9-21)32(40)29-22(13-20-14-36-15-25(29)38-20)27-16-37-28(43-27)7-4-12-42-31-24(35)11-10-23(34)30(31)33/h3,5-6,10-11,16,20-21,25,36,38H,4,7-9,12-15,17H2,1-2H3/t20-,25-/m1/s1 |
| InChIKey | ZHVYPNOIGNAVJT-CJFMBICVSA-N |
| XLogP | 5.68 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.17 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|